C15H14ClFN4O2Pr-2 — CID 163245004
carbanide;6-chloro-5-fluoro-2-[formyl-(4-methyl-2H-pyridin-2-id-3-yl)amino]-N-methylpyridine-3-carboxamide;praseodymium (PubChem CID 163245004) has the molecular formula C15H14ClFN4O2Pr-2 and a molecular weight of 477.66 g/mol. Its IUPAC name is carbanide;6-chloro-5-fluoro-2-[formyl-(4-methyl-2H-pyridin-2-id-3-yl)amino]-N-methylpyridine-3-carboxamide;praseodymium.
| Compound Name | carbanide;6-chloro-5-fluoro-2-[formyl-(4-methyl-2H-pyridin-2-id-3-yl)amino]-N-methylpyridine-3-carboxamide;praseodymium |
|---|---|
| PubChem CID | 163245004 |
| Molecular Formula | C15H14ClFN4O2Pr-2 |
| Molecular Weight | 477.66 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | carbanide;6-chloro-5-fluoro-2-[formyl-(4-methyl-2H-pyridin-2-id-3-yl)amino]-N-methylpyridine-3-carboxamide;praseodymium |
| SMILES | CNC(=O)c1cc(F)c(Cl)nc1N(C=O)c1[c-]nccc1C.[CH3-].[Pr] |
| InChI | InChI=1S/C14H11ClFN4O2.CH3.Pr/c1-8-3-4-18-6-11(8)20(7-21)13-9(14(22)17-2)5-10(16)12(15)19-13;;/h3-5,7H,1-2H3,(H,17,22);1H3;/q2*-1; |
| InChIKey | IIVILEQSHIMTPA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.66 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|