C24H36N2OS — CID 170126483
1-(9-methyl-7-phenyl-7-propan-2-yldecyl)-4-sulfanylidenepyrimidin-2-one (PubChem CID 170126483) has the molecular formula C24H36N2OS and a molecular weight of 400.63 g/mol. Its IUPAC name is 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)-4-sulfanylidenepyrimidin-2-one.
| Compound Name | 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)-4-sulfanylidenepyrimidin-2-one |
|---|---|
| PubChem CID | 170126483 |
| Molecular Formula | C24H36N2OS |
| Molecular Weight | 400.63 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 1-(9-methyl-7-phenyl-7-propan-2-yldecyl)-4-sulfanylidenepyrimidin-2-one |
| SMILES | CC(C)CC(CCCCCCn1ccc(=S)[nH]c1=O)(c1ccccc1)C(C)C |
| InChI | InChI=1S/C24H36N2OS/c1-19(2)18-24(20(3)4,21-12-8-7-9-13-21)15-10-5-6-11-16-26-17-14-22(28)25-23(26)27/h7-9,12-14,17,19-20H,5-6,10-11,15-16,18H2,1-4H3,(H,25,27,28) |
| InChIKey | RNSUPDQKDPITOU-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 37.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.63 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|