C29H37FN2O2S — CID 170127546
N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-(4-fluorophenyl)cyclopropane-1-carboxamide (PubChem CID 170127546) has the molecular formula C29H37FN2O2S and a molecular weight of 496.69 g/mol. Its IUPAC name is N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-(4-fluorophenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-(4-fluorophenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 170127546 |
| Molecular Formula | C29H37FN2O2S |
| Molecular Weight | 496.69 g/mol |
| Exact Mass | 496.26 |
| IUPAC Name | N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-(4-fluorophenyl)cyclopropane-1-carboxamide |
| SMILES | CCc1cc2c(s1)CCO[C@@]21CCN(CC2CC(NC(=O)C3CC3c3ccc(F)cc3)C2)[C@@H](C)C1 |
| InChI | InChI=1S/C29H37FN2O2S/c1-3-23-14-26-27(35-23)8-11-34-29(26)9-10-32(18(2)16-29)17-19-12-22(13-19)31-28(33)25-15-24(25)20-4-6-21(30)7-5-20/h4-7,14,18-19,22,24-25H,3,8-13,15-17H2,1-2H3,(H,31,33)/t18-,19?,22?,24?,25?,29+/m0/s1 |
| InChIKey | FBGHWOOWWOBRSM-DONPTGQDSA-N |
| XLogP | 5.40 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.69 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |