C26H33N3O5S2 — CID 169140245
N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide (PubChem CID 169140245) has the molecular formula C26H33N3O5S2 and a molecular weight of 531.70 g/mol. Its IUPAC name is N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide.
| Compound Name | N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide |
|---|---|
| PubChem CID | 169140245 |
| Molecular Formula | C26H33N3O5S2 |
| Molecular Weight | 531.70 g/mol |
| Exact Mass | 531.19 |
| IUPAC Name | N-[3-[[(2'S,4R)-2-ethyl-2'-methylspiro[6,7-dihydrothieno[3,2-c]pyran-4,4'-piperidine]-1'-yl]methyl]cyclobutyl]-2-oxo-3H-1,3-benzoxazole-6-sulfonamide |
| SMILES | CCc1cc2c(s1)CCO[C@@]21CCN(CC2CC(NS(=O)(=O)c3ccc4[nH]c(=O)oc4c3)C2)[C@@H](C)C1 |
| InChI | InChI=1S/C26H33N3O5S2/c1-3-19-12-21-24(35-19)6-9-33-26(21)7-8-29(16(2)14-26)15-17-10-18(11-17)28-36(31,32)20-4-5-22-23(13-20)34-25(30)27-22/h4-5,12-13,16-18,28H,3,6-11,14-15H2,1-2H3,(H,27,30)/t16-,17?,18?,26+/m0/s1 |
| InChIKey | PBDGPPVTTVXARZ-UVZHGNFQSA-N |
| XLogP | 3.75 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.70 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |