C11H17NO2 — CID 170131029
tert-butyl (4R)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 170131029) has the molecular formula C11H17NO2 and a molecular weight of 195.26 g/mol. Its IUPAC name is tert-butyl (4R)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | tert-butyl (4R)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 170131029 |
| Molecular Formula | C11H17NO2 |
| Molecular Weight | 195.26 g/mol |
| Exact Mass | 195.13 |
| IUPAC Name | tert-butyl (4R)-2-azabicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2C=CC1C2 |
| InChI | InChI=1S/C11H17NO2/c1-11(2,3)14-10(13)12-7-8-4-5-9(12)6-8/h4-5,8-9H,6-7H2,1-3H3/t8-,9?/m0/s1 |
| InChIKey | ZATXHTCUZAWODK-IENPIDJESA-N |
| XLogP | 2.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|