C11H19NO2 — CID 170132643
(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl) nitrite (PubChem CID 170132643) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (3,7-dimethyl-1-bicyclo[3.3.1]nonanyl) nitrite.
| Compound Name | (3,7-dimethyl-1-bicyclo[3.3.1]nonanyl) nitrite |
|---|---|
| PubChem CID | 170132643 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (3,7-dimethyl-1-bicyclo[3.3.1]nonanyl) nitrite |
| SMILES | CC1CC2CC(C)CC(ON=O)(C1)C2 |
| InChI | InChI=1S/C11H19NO2/c1-8-3-10-4-9(2)6-11(5-8,7-10)14-12-13/h8-10H,3-7H2,1-2H3 |
| InChIKey | DIGDLVUGKMXXAP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|