C13H25N — CID 123905764
1-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)ethanamine (PubChem CID 123905764) has the molecular formula C13H25N and a molecular weight of 195.35 g/mol. Its IUPAC name is 1-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)ethanamine.
| Compound Name | 1-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)ethanamine |
|---|---|
| PubChem CID | 123905764 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 1-(3,7-dimethyl-1-bicyclo[3.3.1]nonanyl)ethanamine |
| SMILES | CC1CC2CC(C)CC(C(C)N)(C1)C2 |
| InChI | InChI=1S/C13H25N/c1-9-4-12-5-10(2)7-13(6-9,8-12)11(3)14/h9-12H,4-8,14H2,1-3H3 |
| InChIKey | DJCIYMJGQNPAFD-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |