C12H21NS — CID 23309254
(5S,7S)-3-[(1R)-1-aminoethyl]adamantane-1-thiol (PubChem CID 23309254) has the molecular formula C12H21NS and a molecular weight of 211.37 g/mol. Its IUPAC name is (5S,7S)-3-[(1R)-1-aminoethyl]adamantane-1-thiol.
| Compound Name | (5S,7S)-3-[(1R)-1-aminoethyl]adamantane-1-thiol |
|---|---|
| PubChem CID | 23309254 |
| Molecular Formula | C12H21NS |
| Molecular Weight | 211.37 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | (5S,7S)-3-[(1R)-1-aminoethyl]adamantane-1-thiol |
| SMILES | C[C@@H](N)C12C[C@@H]3C[C@H](CC(S)(C3)C1)C2 |
| InChI | InChI=1S/C12H21NS/c1-8(13)11-3-9-2-10(4-11)6-12(14,5-9)7-11/h8-10,14H,2-7,13H2,1H3/t8-,9+,10+,11?,12?/m1/s1 |
| InChIKey | NASGBIMHXZIRHY-LVGQNXBHSA-N |
| XLogP | 2.60 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.37 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|