C23H44O9S — CID 163608342
2-[2-[2-[2-[2-[2-[(3-methyl-1-bicyclo[3.3.1]nonanyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate (PubChem CID 163608342) has the molecular formula C23H44O9S and a molecular weight of 496.66 g/mol. Its IUPAC name is 2-[2-[2-[2-[2-[2-[(3-methyl-1-bicyclo[3.3.1]nonanyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[2-[2-[2-[2-[(3-methyl-1-bicyclo[3.3.1]nonanyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 163608342 |
| Molecular Formula | C23H44O9S |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | 2-[2-[2-[2-[2-[2-[(3-methyl-1-bicyclo[3.3.1]nonanyl)oxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate |
| SMILES | CC1CC2CCCC(OCCOCCOCCOCCOCCOCCOS(C)(=O)=O)(C1)C2 |
| InChI | InChI=1S/C23H44O9S/c1-21-18-22-4-3-5-23(19-21,20-22)31-16-14-29-12-10-27-8-6-26-7-9-28-11-13-30-15-17-32-33(2,24)25/h21-22H,3-20H2,1-2H3 |
| InChIKey | HDTBTMIBHZBPNP-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|