C16H28ClNO3 — CID 129058819
2-[2-[[2-(3-methyl-1-bicyclo[3.3.1]nonanyl)acetyl]amino]ethoxy]ethyl hypochlorite (PubChem CID 129058819) has the molecular formula C16H28ClNO3 and a molecular weight of 317.86 g/mol. Its IUPAC name is 2-[2-[[2-(3-methyl-1-bicyclo[3.3.1]nonanyl)acetyl]amino]ethoxy]ethyl hypochlorite.
| Compound Name | 2-[2-[[2-(3-methyl-1-bicyclo[3.3.1]nonanyl)acetyl]amino]ethoxy]ethyl hypochlorite |
|---|---|
| PubChem CID | 129058819 |
| Molecular Formula | C16H28ClNO3 |
| Molecular Weight | 317.86 g/mol |
| Exact Mass | 317.18 |
| IUPAC Name | 2-[2-[[2-(3-methyl-1-bicyclo[3.3.1]nonanyl)acetyl]amino]ethoxy]ethyl hypochlorite |
| SMILES | CC1CC2CCCC(CC(=O)NCCOCCOCl)(C1)C2 |
| InChI | InChI=1S/C16H28ClNO3/c1-13-9-14-3-2-4-16(10-13,11-14)12-15(19)18-5-6-20-7-8-21-17/h13-14H,2-12H2,1H3,(H,18,19) |
| InChIKey | YYTYQHIFWWDMAU-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.86 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|