C15H26O6S — CID 172611502
2-[2-[2-(2-bicyclo[2.2.1]hept-5-enylmethoxy)ethoxy]ethoxy]ethyl methanesulfonate (PubChem CID 172611502) has the molecular formula C15H26O6S and a molecular weight of 334.43 g/mol. Its IUPAC name is 2-[2-[2-(2-bicyclo[2.2.1]hept-5-enylmethoxy)ethoxy]ethoxy]ethyl methanesulfonate.
| Compound Name | 2-[2-[2-(2-bicyclo[2.2.1]hept-5-enylmethoxy)ethoxy]ethoxy]ethyl methanesulfonate |
|---|---|
| PubChem CID | 172611502 |
| Molecular Formula | C15H26O6S |
| Molecular Weight | 334.43 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | 2-[2-[2-(2-bicyclo[2.2.1]hept-5-enylmethoxy)ethoxy]ethoxy]ethyl methanesulfonate |
| SMILES | CS(=O)(=O)OCCOCCOCCOCC1CC2C=CC1C2 |
| InChI | InChI=1S/C15H26O6S/c1-22(16,17)21-9-8-19-5-4-18-6-7-20-12-15-11-13-2-3-14(15)10-13/h2-3,13-15H,4-12H2,1H3 |
| InChIKey | KTRQHBRGLZQMMT-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|