C20H28O6S — CID 118233238
2-[2-[2-[[(1R)-2-bicyclo[2.2.0]hex-5-enyl]methoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate (PubChem CID 118233238) has the molecular formula C20H28O6S and a molecular weight of 396.51 g/mol. Its IUPAC name is 2-[2-[2-[[(1R)-2-bicyclo[2.2.0]hex-5-enyl]methoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate.
| Compound Name | 2-[2-[2-[[(1R)-2-bicyclo[2.2.0]hex-5-enyl]methoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 118233238 |
| Molecular Formula | C20H28O6S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | 2-[2-[2-[[(1R)-2-bicyclo[2.2.0]hex-5-enyl]methoxy]ethoxy]ethoxy]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCC2CC3C=C[C@H]32)cc1 |
| InChI | InChI=1S/C20H28O6S/c1-16-2-5-19(6-3-16)27(21,22)26-13-12-24-9-8-23-10-11-25-15-18-14-17-4-7-20(17)18/h2-7,17-18,20H,8-15H2,1H3/t17?,18?,20-/m1/s1 |
| InChIKey | DUTAZSVUEIWBNT-AFMYVXGZSA-N |
| XLogP | 2.57 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|