C22H41NO5 — CID 166800863
tert-butyl N-methyl-N-[2-[2-[2-[(3-methyl-1-bicyclo[3.3.1]nonanyl)oxy]ethoxy]ethoxy]ethyl]carbamate (PubChem CID 166800863) has the molecular formula C22H41NO5 and a molecular weight of 399.57 g/mol. Its IUPAC name is tert-butyl N-methyl-N-[2-[2-[2-[(3-methyl-1-bicyclo[3.3.1]nonanyl)oxy]ethoxy]ethoxy]ethyl]carbamate.
| Compound Name | tert-butyl N-methyl-N-[2-[2-[2-[(3-methyl-1-bicyclo[3.3.1]nonanyl)oxy]ethoxy]ethoxy]ethyl]carbamate |
|---|---|
| PubChem CID | 166800863 |
| Molecular Formula | C22H41NO5 |
| Molecular Weight | 399.57 g/mol |
| Exact Mass | 399.30 |
| IUPAC Name | tert-butyl N-methyl-N-[2-[2-[2-[(3-methyl-1-bicyclo[3.3.1]nonanyl)oxy]ethoxy]ethoxy]ethyl]carbamate |
| SMILES | CC1CC2CCCC(OCCOCCOCCN(C)C(=O)OC(C)(C)C)(C1)C2 |
| InChI | InChI=1S/C22H41NO5/c1-18-15-19-7-6-8-22(16-18,17-19)27-14-13-26-12-11-25-10-9-23(5)20(24)28-21(2,3)4/h18-19H,6-17H2,1-5H3 |
| InChIKey | MUYUEDBPFNNOHT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|