C17H32O8S — CID 122573455
tert-butyl 1-[2-[2-(2-methylsulfonyloxyethoxy)ethoxy]ethoxy]cyclopentane-1-carboxylate (PubChem CID 122573455) has the molecular formula C17H32O8S and a molecular weight of 396.50 g/mol. Its IUPAC name is tert-butyl 1-[2-[2-(2-methylsulfonyloxyethoxy)ethoxy]ethoxy]cyclopentane-1-carboxylate.
| Compound Name | tert-butyl 1-[2-[2-(2-methylsulfonyloxyethoxy)ethoxy]ethoxy]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 122573455 |
| Molecular Formula | C17H32O8S |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | tert-butyl 1-[2-[2-(2-methylsulfonyloxyethoxy)ethoxy]ethoxy]cyclopentane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1(OCCOCCOCCOS(C)(=O)=O)CCCC1 |
| InChI | InChI=1S/C17H32O8S/c1-16(2,3)25-15(18)17(7-5-6-8-17)23-13-11-21-9-10-22-12-14-24-26(4,19)20/h5-14H2,1-4H3 |
| InChIKey | OSCYZJGAXQQETL-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|