C14H19NO2 — CID 170137214
4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide (PubChem CID 170137214) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide.
| Compound Name | 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide |
|---|---|
| PubChem CID | 170137214 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide |
| SMILES | C/C=C\[C@@](C)(CC)Oc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C14H19NO2/c1-4-10-14(3,5-2)17-12-8-6-11(7-9-12)13(15)16/h4,6-10H,5H2,1-3H3,(H2,15,16)/b10-4-/t14-/m1/s1 |
| InChIKey | MOZKUTGJULHTDH-PXTDYPQFSA-N |
| XLogP | 2.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|