About 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide
4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide (PubChem CID 170137214) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide.
Molecular Properties
| Compound Name | 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide |
| PubChem CID | 170137214 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide |
| SMILES | C/C=C\[C@@](C)(CC)Oc1ccc(C(N)=O)cc1 |
| InChI | InChI=1S/C14H19NO2/c1-4-10-14(3,5-2)17-12-8-6-11(7-9-12)13(15)16/h4,6-10H,5H2,1-3H3,(H2,15,16)/b10-4-/t14-/m1/s1 |
| InChIKey | MOZKUTGJULHTDH-PXTDYPQFSA-N |
| XLogP | 2.91 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide?
The IUPAC name of 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide (CID 170137214) is 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide.
What is the SMILES notation for 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide?
The canonical SMILES for 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide is C/C=C\[C@@](C)(CC)Oc1ccc(C(N)=O)cc1.
What is the InChIKey of 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide?
The InChIKey is MOZKUTGJULHTDH-PXTDYPQFSA-N. The full InChI is InChI=1S/C14H19NO2/c1-4-10-14(3,5-2)17-12-8-6-11(7-9-12)13(15)16/h4,6-10H,5H2,1-3H3,(H2,15,16)/b10-4-/t14-/m1/s1.
What are the key properties of 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide?
4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide has a molecular weight of 233.31 g/mol, XLogP of 2.91, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(Z,3R)-3-methylhex-4-en-3-yl]oxybenzamide is sourced from PubChem (CID 170137214), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).