C19H28N4O2 — CID 170141819
6-[(2-butan-2-yl-2-azabicyclo[2.1.1]hexan-4-yl)methyl]-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide (PubChem CID 170141819) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is 6-[(2-butan-2-yl-2-azabicyclo[2.1.1]hexan-4-yl)methyl]-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide.
| Compound Name | 6-[(2-butan-2-yl-2-azabicyclo[2.1.1]hexan-4-yl)methyl]-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 170141819 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | 6-[(2-butan-2-yl-2-azabicyclo[2.1.1]hexan-4-yl)methyl]-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide |
| SMILES | CCC(C)N1CC2(CN3CCc4ncc(C(=O)NO)cc4C3)CC1C2 |
| InChI | InChI=1S/C19H28N4O2/c1-3-13(2)23-12-19(7-16(23)8-19)11-22-5-4-17-15(10-22)6-14(9-20-17)18(24)21-25/h6,9,13,16,25H,3-5,7-8,10-12H2,1-2H3,(H,21,24) |
| InChIKey | KNXIOZYQBUPBQM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 68.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|