C22H31N3O2 — CID 170133759
7-[(1S)-1-(1-adamantyl)propyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide (PubChem CID 170133759) has the molecular formula C22H31N3O2 and a molecular weight of 369.51 g/mol. Its IUPAC name is 7-[(1S)-1-(1-adamantyl)propyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide.
| Compound Name | 7-[(1S)-1-(1-adamantyl)propyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 170133759 |
| Molecular Formula | C22H31N3O2 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.24 |
| IUPAC Name | 7-[(1S)-1-(1-adamantyl)propyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
| SMILES | CC[C@H](N1CCc2cc(C(=O)NO)cnc2C1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H31N3O2/c1-2-20(22-9-14-5-15(10-22)7-16(6-14)11-22)25-4-3-17-8-18(21(26)24-27)12-23-19(17)13-25/h8,12,14-16,20,27H,2-7,9-11,13H2,1H3,(H,24,26)/t14?,15?,16?,20-,22?/m0/s1 |
| InChIKey | JTCJLEQOVHDKRO-KNBKFLTOSA-N |
| XLogP | 3.55 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|