C16H23N3O3 — CID 160731359
6-[(2R)-2-ethyl-3-methylbutanoyl]-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide (PubChem CID 160731359) has the molecular formula C16H23N3O3 and a molecular weight of 305.38 g/mol. Its IUPAC name is 6-[(2R)-2-ethyl-3-methylbutanoyl]-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide.
| Compound Name | 6-[(2R)-2-ethyl-3-methylbutanoyl]-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 160731359 |
| Molecular Formula | C16H23N3O3 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.17 |
| IUPAC Name | 6-[(2R)-2-ethyl-3-methylbutanoyl]-N-hydroxy-7,8-dihydro-5H-1,6-naphthyridine-3-carboxamide |
| SMILES | CC[C@@H](C(=O)N1CCc2ncc(C(=O)NO)cc2C1)C(C)C |
| InChI | InChI=1S/C16H23N3O3/c1-4-13(10(2)3)16(21)19-6-5-14-12(9-19)7-11(8-17-14)15(20)18-22/h7-8,10,13,22H,4-6,9H2,1-3H3,(H,18,20)/t13-/m1/s1 |
| InChIKey | ZKBHVBMQBPRTPP-CYBMUJFWSA-N |
| XLogP | 1.77 |
| TPSA | 82.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|