C24H35N3O2 — CID 169125933
7-[1-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)cyclobutyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide (PubChem CID 169125933) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 7-[1-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)cyclobutyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide.
| Compound Name | 7-[1-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)cyclobutyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 169125933 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 7-[1-(3,7-dimethyl-3-bicyclo[3.3.1]nonanyl)cyclobutyl]-N-hydroxy-6,8-dihydro-5H-1,7-naphthyridine-3-carboxamide |
| SMILES | CC1CC2CC(C1)CC(C)(C1(N3CCc4cc(C(=O)NO)cnc4C3)CCC1)C2 |
| InChI | InChI=1S/C24H35N3O2/c1-16-8-17-10-18(9-16)13-23(2,12-17)24(5-3-6-24)27-7-4-19-11-20(22(28)26-29)14-25-21(19)15-27/h11,14,16-18,29H,3-10,12-13,15H2,1-2H3,(H,26,28) |
| InChIKey | XGHAIPPLOXJQOS-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|