C32H35F6N3 — CID 170142023
N-[1-[4-[1-[amino(tert-butyl)amino]ethenyl]phenyl]ethenyl]-4-[4-tert-butyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline (PubChem CID 170142023) has the molecular formula C32H35F6N3 and a molecular weight of 575.64 g/mol. Its IUPAC name is N-[1-[4-[1-[amino(tert-butyl)amino]ethenyl]phenyl]ethenyl]-4-[4-tert-butyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline.
| Compound Name | N-[1-[4-[1-[amino(tert-butyl)amino]ethenyl]phenyl]ethenyl]-4-[4-tert-butyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 170142023 |
| Molecular Formula | C32H35F6N3 |
| Molecular Weight | 575.64 g/mol |
| Exact Mass | 575.27 |
| IUPAC Name | N-[1-[4-[1-[amino(tert-butyl)amino]ethenyl]phenyl]ethenyl]-4-[4-tert-butyl-2-(trifluoromethyl)phenyl]-3-(trifluoromethyl)aniline |
| SMILES | C=C(Nc1ccc(-c2ccc(C(C)(C)C)cc2C(F)(F)F)c(C(F)(F)F)c1)c1ccc(C(=C)N(N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C32H35F6N3/c1-19(21-9-11-22(12-10-21)20(2)41(39)30(6,7)8)40-24-14-16-26(28(18-24)32(36,37)38)25-15-13-23(29(3,4)5)17-27(25)31(33,34)35/h9-18,40H,1-2,39H2,3-8H3 |
| InChIKey | ULNUDGDGGANWJT-UHFFFAOYSA-N |
| XLogP | 9.72 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.64 |
| LogP ≤ 5 | 9.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|