C13H13F3N2S — CID 156841924
4-[(3-methyl-4-sulfanylbut-1-en-2-yl)amino]-2-(trifluoromethyl)benzonitrile (PubChem CID 156841924) has the molecular formula C13H13F3N2S and a molecular weight of 286.32 g/mol. Its IUPAC name is 4-[(3-methyl-4-sulfanylbut-1-en-2-yl)amino]-2-(trifluoromethyl)benzonitrile.
| Compound Name | 4-[(3-methyl-4-sulfanylbut-1-en-2-yl)amino]-2-(trifluoromethyl)benzonitrile |
|---|---|
| PubChem CID | 156841924 |
| Molecular Formula | C13H13F3N2S |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | 4-[(3-methyl-4-sulfanylbut-1-en-2-yl)amino]-2-(trifluoromethyl)benzonitrile |
| SMILES | C=C(Nc1ccc(C#N)c(C(F)(F)F)c1)C(C)CS |
| InChI | InChI=1S/C13H13F3N2S/c1-8(7-19)9(2)18-11-4-3-10(6-17)12(5-11)13(14,15)16/h3-5,8,18-19H,2,7H2,1H3 |
| InChIKey | HMXGXTZDJFCONU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.32 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|