C18H24F3N3OS — CID 170143577
2-[[2,4-dimethyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane (PubChem CID 170143577) has the molecular formula C18H24F3N3OS and a molecular weight of 387.47 g/mol. Its IUPAC name is 2-[[2,4-dimethyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane.
| Compound Name | 2-[[2,4-dimethyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 170143577 |
| Molecular Formula | C18H24F3N3OS |
| Molecular Weight | 387.47 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 2-[[2,4-dimethyl-6-(trifluoromethyl)-3-pyridinyl]sulfanyl]-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane |
| SMILES | Cc1cc(C(F)(F)F)nc(C)c1SN1CC2(C1)CN(C1CCOCC1)C2 |
| InChI | InChI=1S/C18H24F3N3OS/c1-12-7-15(18(19,20)21)22-13(2)16(12)26-24-10-17(11-24)8-23(9-17)14-3-5-25-6-4-14/h7,14H,3-6,8-11H2,1-2H3 |
| InChIKey | FVCKXPGODQUIAV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 28.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.47 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|