C16H24F2N4OS — CID 170143982
2-[3-(1,1-difluoroethyl)-1-methylpyrazol-5-yl]sulfanyl-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane (PubChem CID 170143982) has the molecular formula C16H24F2N4OS and a molecular weight of 358.46 g/mol. Its IUPAC name is 2-[3-(1,1-difluoroethyl)-1-methylpyrazol-5-yl]sulfanyl-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane.
| Compound Name | 2-[3-(1,1-difluoroethyl)-1-methylpyrazol-5-yl]sulfanyl-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 170143982 |
| Molecular Formula | C16H24F2N4OS |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 2-[3-(1,1-difluoroethyl)-1-methylpyrazol-5-yl]sulfanyl-6-(oxan-4-yl)-2,6-diazaspiro[3.3]heptane |
| SMILES | Cn1nc(C(C)(F)F)cc1SN1CC2(C1)CN(C1CCOCC1)C2 |
| InChI | InChI=1S/C16H24F2N4OS/c1-15(17,18)13-7-14(20(2)19-13)24-22-10-16(11-22)8-21(9-16)12-3-5-23-6-4-12/h7,12H,3-6,8-11H2,1-2H3 |
| InChIKey | JIPDUSHSLQCUFR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|