C15H24N4O8 — CID 170149546
2-[(2-carboxyacetyl)amino]-5-oxo-5-[[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]amino]pentanoic acid (PubChem CID 170149546) has the molecular formula C15H24N4O8 and a molecular weight of 388.38 g/mol. Its IUPAC name is 2-[(2-carboxyacetyl)amino]-5-oxo-5-[[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]amino]pentanoic acid.
| Compound Name | 2-[(2-carboxyacetyl)amino]-5-oxo-5-[[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 170149546 |
| Molecular Formula | C15H24N4O8 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | 2-[(2-carboxyacetyl)amino]-5-oxo-5-[[2-oxo-2-[[2-oxo-2-(propylamino)ethyl]amino]ethyl]amino]pentanoic acid |
| SMILES | CCCNC(=O)CNC(=O)CNC(=O)CCC(NC(=O)CC(=O)O)C(=O)O |
| InChI | InChI=1S/C15H24N4O8/c1-2-5-16-12(22)7-18-13(23)8-17-10(20)4-3-9(15(26)27)19-11(21)6-14(24)25/h9H,2-8H2,1H3,(H,16,22)(H,17,20)(H,18,23)(H,19,21)(H,24,25)(H,26,27) |
| InChIKey | JKFLJPBKWRCWSX-UHFFFAOYSA-N |
| XLogP | -2.43 |
| TPSA | 191.00 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | -2.43 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|