2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid

C5H6O3S3 — CID 170150780

IUPAC2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid
SMILESO=CCSC(=S)SCC(=O)O
InChIInChI=1S/C5H6O3S3/c6-1-2-10-5(9)11-3-4(7)8/h1H,2-3H2,(H,7,8)
InChIKeyPOAGOHJTKYIXEQ-UHFFFAOYSA-N
MW210.30 g/mol
LogP1.02
Rot. Bonds4

About 2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid

2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid (PubChem CID 170150780) has the molecular formula C5H6O3S3 and a molecular weight of 210.30 g/mol. Its IUPAC name is 2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid.

Molecular Properties

Compound Name2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid
PubChem CID170150780
Molecular FormulaC5H6O3S3
Molecular Weight210.30 g/mol
Exact Mass209.95
IUPAC Name2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid
SMILESO=CCSC(=S)SCC(=O)O
InChIInChI=1S/C5H6O3S3/c6-1-2-10-5(9)11-3-4(7)8/h1H,2-3H2,(H,7,8)
InChIKeyPOAGOHJTKYIXEQ-UHFFFAOYSA-N
XLogP1.02
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms11
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.30
LogP ≤ 51.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}

Analyze 2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid?
The IUPAC name of 2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid (CID 170150780) is 2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid.
What is the SMILES notation for 2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid?
The canonical SMILES for 2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid is O=CCSC(=S)SCC(=O)O.
What is the InChIKey of 2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid?
The InChIKey is POAGOHJTKYIXEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6O3S3/c6-1-2-10-5(9)11-3-4(7)8/h1H,2-3H2,(H,7,8).
What are the key properties of 2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid?
2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid has a molecular weight of 210.30 g/mol, XLogP of 1.02, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-oxoethylsulfanylcarbothioylsulfanyl)acetic acid is sourced from PubChem (CID 170150780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).