C8H12N2NaO4S4+ — CID 54602198
sodium 2-[2-(carboxymethylsulfanylcarbothioylamino)ethylcarbamothioylsulfanyl]acetic acid (PubChem CID 54602198) has the molecular formula C8H12N2NaO4S4+ and a molecular weight of 351.45 g/mol. Its IUPAC name is sodium 2-[2-(carboxymethylsulfanylcarbothioylamino)ethylcarbamothioylsulfanyl]acetic acid.
| Compound Name | sodium 2-[2-(carboxymethylsulfanylcarbothioylamino)ethylcarbamothioylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 54602198 |
| Molecular Formula | C8H12N2NaO4S4+ |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 350.96 |
| IUPAC Name | sodium 2-[2-(carboxymethylsulfanylcarbothioylamino)ethylcarbamothioylsulfanyl]acetic acid |
| SMILES | O=C(O)CSC(=S)NCCNC(=S)SCC(=O)O.[Na+] |
| InChI | InChI=1S/C8H12N2O4S4.Na/c11-5(12)3-17-7(15)9-1-2-10-8(16)18-4-6(13)14;/h1-4H2,(H,9,15)(H,10,16)(H,11,12)(H,13,14);/q;+1 |
| InChIKey | SBRVKRIDESICOG-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|