C9H18N2O3S3 — CID 10402443
(2R)-2-amino-3-(4-methylsulfinylbutylcarbamothioylsulfanyl)propanoic acid (PubChem CID 10402443) has the molecular formula C9H18N2O3S3 and a molecular weight of 298.46 g/mol. Its IUPAC name is (2R)-2-amino-3-(4-methylsulfinylbutylcarbamothioylsulfanyl)propanoic acid.
| Compound Name | (2R)-2-amino-3-(4-methylsulfinylbutylcarbamothioylsulfanyl)propanoic acid |
|---|---|
| PubChem CID | 10402443 |
| Molecular Formula | C9H18N2O3S3 |
| Molecular Weight | 298.46 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | (2R)-2-amino-3-(4-methylsulfinylbutylcarbamothioylsulfanyl)propanoic acid |
| SMILES | CS(=O)CCCCNC(=S)SC[C@H](N)C(=O)O |
| InChI | InChI=1S/C9H18N2O3S3/c1-17(14)5-3-2-4-11-9(15)16-6-7(10)8(12)13/h7H,2-6,10H2,1H3,(H,11,15)(H,12,13)/t7-,17?/m0/s1 |
| InChIKey | PUPMSTCTVNEOCX-ISJKBYAMSA-N |
| XLogP | 0.16 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.46 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|