C10H19N3O4S3 — CID 86253910
2-[[2-amino-3-(3-methylsulfinylpropylcarbamothioylsulfanyl)propanoyl]amino]acetic acid (PubChem CID 86253910) has the molecular formula C10H19N3O4S3 and a molecular weight of 341.48 g/mol. Its IUPAC name is 2-[[2-amino-3-(3-methylsulfinylpropylcarbamothioylsulfanyl)propanoyl]amino]acetic acid.
| Compound Name | 2-[[2-amino-3-(3-methylsulfinylpropylcarbamothioylsulfanyl)propanoyl]amino]acetic acid |
|---|---|
| PubChem CID | 86253910 |
| Molecular Formula | C10H19N3O4S3 |
| Molecular Weight | 341.48 g/mol |
| Exact Mass | 341.05 |
| IUPAC Name | 2-[[2-amino-3-(3-methylsulfinylpropylcarbamothioylsulfanyl)propanoyl]amino]acetic acid |
| SMILES | CS(=O)CCCNC(=S)SCC(N)C(=O)NCC(=O)O |
| InChI | InChI=1S/C10H19N3O4S3/c1-20(17)4-2-3-12-10(18)19-6-7(11)9(16)13-5-8(14)15/h7H,2-6,11H2,1H3,(H,12,18)(H,13,16)(H,14,15) |
| InChIKey | DPNSNZWERSTHLI-UHFFFAOYSA-N |
| XLogP | -1.11 |
| TPSA | 121.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.48 |
| LogP ≤ 5 | -1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|