C13H19NOS3 — CID 11500431
benzyl N-(4-methylsulfinylbutyl)carbamodithioate (PubChem CID 11500431) has the molecular formula C13H19NOS3 and a molecular weight of 301.50 g/mol. Its IUPAC name is benzyl N-(4-methylsulfinylbutyl)carbamodithioate.
| Compound Name | benzyl N-(4-methylsulfinylbutyl)carbamodithioate |
|---|---|
| PubChem CID | 11500431 |
| Molecular Formula | C13H19NOS3 |
| Molecular Weight | 301.50 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | benzyl N-(4-methylsulfinylbutyl)carbamodithioate |
| SMILES | CS(=O)CCCCNC(=S)SCc1ccccc1 |
| InChI | InChI=1S/C13H19NOS3/c1-18(15)10-6-5-9-14-13(16)17-11-12-7-3-2-4-8-12/h2-4,7-8H,5-6,9-11H2,1H3,(H,14,16) |
| InChIKey | SHILGOYVXPZMTK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.50 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|