C6H12N2S4 — CID 2754715
methyl N-[2-(methylsulfanylcarbothioylamino)ethyl]carbamodithioate (PubChem CID 2754715) has the molecular formula C6H12N2S4 and a molecular weight of 240.44 g/mol. Its IUPAC name is methyl N-[2-(methylsulfanylcarbothioylamino)ethyl]carbamodithioate.
| Compound Name | methyl N-[2-(methylsulfanylcarbothioylamino)ethyl]carbamodithioate |
|---|---|
| PubChem CID | 2754715 |
| Molecular Formula | C6H12N2S4 |
| Molecular Weight | 240.44 g/mol |
| Exact Mass | 239.99 |
| IUPAC Name | methyl N-[2-(methylsulfanylcarbothioylamino)ethyl]carbamodithioate |
| SMILES | CSC(=S)NCCNC(=S)SC |
| InChI | InChI=1S/C6H12N2S4/c1-11-5(9)7-3-4-8-6(10)12-2/h3-4H2,1-2H3,(H,7,9)(H,8,10) |
| InChIKey | KUUUDIJBRGBBNC-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|