C7H13MnNS4 — CID 58312456
carbanide;manganese(2+);4-(methylsulfanylcarbothioylamino)butanedithioate (PubChem CID 58312456) has the molecular formula C7H13MnNS4 and a molecular weight of 294.39 g/mol. Its IUPAC name is carbanide;manganese(2+);4-(methylsulfanylcarbothioylamino)butanedithioate.
| Compound Name | carbanide;manganese(2+);4-(methylsulfanylcarbothioylamino)butanedithioate |
|---|---|
| PubChem CID | 58312456 |
| Molecular Formula | C7H13MnNS4 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 293.93 |
| IUPAC Name | carbanide;manganese(2+);4-(methylsulfanylcarbothioylamino)butanedithioate |
| SMILES | CSC(=S)NCCCC(=S)[S-].[CH3-].[Mn+2] |
| InChI | InChI=1S/C6H11NS4.CH3.Mn/c1-11-6(10)7-4-2-3-5(8)9;;/h2-4H2,1H3,(H,7,10)(H,8,9);1H3;/q;-1;+2/p-1 |
| InChIKey | SIVBOLUMHHQBHU-UHFFFAOYSA-M |
| XLogP | 2.33 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|