C8H15FN2 — CID 170151655
2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane (PubChem CID 170151655) has the molecular formula C8H15FN2 and a molecular weight of 158.22 g/mol. Its IUPAC name is 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane.
| Compound Name | 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane |
|---|---|
| PubChem CID | 170151655 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane |
| SMILES | FCCCN1CC2(CNC2)C1 |
| InChI | InChI=1S/C8H15FN2/c9-2-1-3-11-6-8(7-11)4-10-5-8/h10H,1-7H2 |
| InChIKey | CLAQZKLPZLSVDQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |