About 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane
2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane (PubChem CID 170151655) has the molecular formula C8H15FN2
and a molecular weight of 158.22 g/mol. Its IUPAC name is 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane |
| PubChem CID | 170151655 |
| Molecular Formula | C8H15FN2 |
| Molecular Weight | 158.22 g/mol |
| Exact Mass | 158.12 |
| IUPAC Name | 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane |
| SMILES | FCCCN1CC2(CNC2)C1 |
| InChI | InChI=1S/C8H15FN2/c9-2-1-3-11-6-8(7-11)4-10-5-8/h10H,1-7H2 |
| InChIKey | CLAQZKLPZLSVDQ-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.22 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane?
The IUPAC name of 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane (CID 170151655) is 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane.
What is the SMILES notation for 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane?
The canonical SMILES for 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane is FCCCN1CC2(CNC2)C1.
What is the InChIKey of 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane?
The InChIKey is CLAQZKLPZLSVDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15FN2/c9-2-1-3-11-6-8(7-11)4-10-5-8/h10H,1-7H2.
What are the key properties of 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane?
2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane has a molecular weight of 158.22 g/mol, XLogP of 0.25, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-fluoropropyl)-2,6-diazaspiro[3.3]heptane is sourced from PubChem (CID 170151655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).