About 2-butyl-2,6-diazaspiro[3.3]heptane
2-butyl-2,6-diazaspiro[3.3]heptane (PubChem CID 159477315) has the molecular formula C9H18N2
and a molecular weight of 154.26 g/mol. Its IUPAC name is 2-butyl-2,6-diazaspiro[3.3]heptane.
Molecular Properties
| Compound Name | 2-butyl-2,6-diazaspiro[3.3]heptane |
| PubChem CID | 159477315 |
| Molecular Formula | C9H18N2 |
| Molecular Weight | 154.26 g/mol |
| Exact Mass | 154.15 |
| IUPAC Name | 2-butyl-2,6-diazaspiro[3.3]heptane |
| SMILES | CCCCN1CC2(CNC2)C1 |
| InChI | InChI=1S/C9H18N2/c1-2-3-4-11-7-9(8-11)5-10-6-9/h10H,2-8H2,1H3 |
| InChIKey | OWSIRHZGKKJDMT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.26 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-butyl-2,6-diazaspiro[3.3]heptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-butyl-2,6-diazaspiro[3.3]heptane?
The IUPAC name of 2-butyl-2,6-diazaspiro[3.3]heptane (CID 159477315) is 2-butyl-2,6-diazaspiro[3.3]heptane.
What is the SMILES notation for 2-butyl-2,6-diazaspiro[3.3]heptane?
The canonical SMILES for 2-butyl-2,6-diazaspiro[3.3]heptane is CCCCN1CC2(CNC2)C1.
What is the InChIKey of 2-butyl-2,6-diazaspiro[3.3]heptane?
The InChIKey is OWSIRHZGKKJDMT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2/c1-2-3-4-11-7-9(8-11)5-10-6-9/h10H,2-8H2,1H3.
What are the key properties of 2-butyl-2,6-diazaspiro[3.3]heptane?
2-butyl-2,6-diazaspiro[3.3]heptane has a molecular weight of 154.26 g/mol, XLogP of 0.69, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butyl-2,6-diazaspiro[3.3]heptane is sourced from PubChem (CID 159477315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).