C26H21Cl2NO3 — CID 170153658
4-[4-[3-(3,4-dichlorophenyl)-3-oxopropyl]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 170153658) has the molecular formula C26H21Cl2NO3 and a molecular weight of 466.36 g/mol. Its IUPAC name is 4-[4-[3-(3,4-dichlorophenyl)-3-oxopropyl]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | 4-[4-[3-(3,4-dichlorophenyl)-3-oxopropyl]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 170153658 |
| Molecular Formula | C26H21Cl2NO3 |
| Molecular Weight | 466.36 g/mol |
| Exact Mass | 465.09 |
| IUPAC Name | 4-[4-[3-(3,4-dichlorophenyl)-3-oxopropyl]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C(CCc1ccc(N2C(=O)C3C4C=CC(C5CC45)C3C2=O)cc1)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C26H21Cl2NO3/c27-20-9-4-14(11-21(20)28)22(30)10-3-13-1-5-15(6-2-13)29-25(31)23-16-7-8-17(19-12-18(16)19)24(23)26(29)32/h1-2,4-9,11,16-19,23-24H,3,10,12H2 |
| InChIKey | CZKBIVMVKGYSOL-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.36 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|