C26H19Cl2NO4 — CID 170153706
4-[4-[3-(3,4-dichlorobenzoyl)oxiran-2-yl]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione (PubChem CID 170153706) has the molecular formula C26H19Cl2NO4 and a molecular weight of 480.35 g/mol. Its IUPAC name is 4-[4-[3-(3,4-dichlorobenzoyl)oxiran-2-yl]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione.
| Compound Name | 4-[4-[3-(3,4-dichlorobenzoyl)oxiran-2-yl]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
|---|---|
| PubChem CID | 170153706 |
| Molecular Formula | C26H19Cl2NO4 |
| Molecular Weight | 480.35 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 4-[4-[3-(3,4-dichlorobenzoyl)oxiran-2-yl]phenyl]-4-azatetracyclo[5.3.2.02,6.08,10]dodec-11-ene-3,5-dione |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)C1OC1c1ccc(N2C(=O)C3C4C=CC(C5CC45)C3C2=O)cc1 |
| InChI | InChI=1S/C26H19Cl2NO4/c27-18-8-3-12(9-19(18)28)22(30)24-23(33-24)11-1-4-13(5-2-11)29-25(31)20-14-6-7-15(17-10-16(14)17)21(20)26(29)32/h1-9,14-17,20-21,23-24H,10H2 |
| InChIKey | QRCGILVTUWIHAA-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 66.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.35 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|