C18H29F3NO3S- — CID 170154182
6-[oxido(trifluoromethylsulfanyl)amino]hexyl 3-methylbicyclo[3.3.1]nonane-1-carboxylate (PubChem CID 170154182) has the molecular formula C18H29F3NO3S- and a molecular weight of 396.50 g/mol. Its IUPAC name is 6-[oxido(trifluoromethylsulfanyl)amino]hexyl 3-methylbicyclo[3.3.1]nonane-1-carboxylate.
| Compound Name | 6-[oxido(trifluoromethylsulfanyl)amino]hexyl 3-methylbicyclo[3.3.1]nonane-1-carboxylate |
|---|---|
| PubChem CID | 170154182 |
| Molecular Formula | C18H29F3NO3S- |
| Molecular Weight | 396.50 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 6-[oxido(trifluoromethylsulfanyl)amino]hexyl 3-methylbicyclo[3.3.1]nonane-1-carboxylate |
| SMILES | CC1CC2CCCC(C(=O)OCCCCCCN([O-])SC(F)(F)F)(C1)C2 |
| InChI | InChI=1S/C18H29F3NO3S/c1-14-11-15-7-6-8-17(12-14,13-15)16(23)25-10-5-3-2-4-9-22(24)26-18(19,20)21/h14-15H,2-13H2,1H3/q-1 |
| InChIKey | VGSCOEPJFVNQKZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.50 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|