C11H15N3O3 — CID 170163856
(2R,3S,5R)-5-(4-amino-2H-pyrimidin-1-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 170163856) has the molecular formula C11H15N3O3 and a molecular weight of 237.26 g/mol. Its IUPAC name is (2R,3S,5R)-5-(4-amino-2H-pyrimidin-1-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,3S,5R)-5-(4-amino-2H-pyrimidin-1-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 170163856 |
| Molecular Formula | C11H15N3O3 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.11 |
| IUPAC Name | (2R,3S,5R)-5-(4-amino-2H-pyrimidin-1-yl)-2-ethynyl-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | C#C[C@]1(CO)O[C@@H](N2C=CC(N)=NC2)C[C@@H]1O |
| InChI | InChI=1S/C11H15N3O3/c1-2-11(6-15)8(16)5-10(17-11)14-4-3-9(12)13-7-14/h1,3-4,8,10,15-16H,5-7H2,(H2,12,13)/t8-,10+,11+/m0/s1 |
| InChIKey | SVGWKCHJIBCKPO-JMJZKYOTSA-N |
| XLogP | -1.40 |
| TPSA | 91.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | -1.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|