C16H19FN2O7 — CID 170172269
[(2R,5S)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-methyl-2H-furan-5-yl]methyl 2-acetyloxy-2-methylpropanoate (PubChem CID 170172269) has the molecular formula C16H19FN2O7 and a molecular weight of 370.33 g/mol. Its IUPAC name is [(2R,5S)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-methyl-2H-furan-5-yl]methyl 2-acetyloxy-2-methylpropanoate.
| Compound Name | [(2R,5S)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-methyl-2H-furan-5-yl]methyl 2-acetyloxy-2-methylpropanoate |
|---|---|
| PubChem CID | 170172269 |
| Molecular Formula | C16H19FN2O7 |
| Molecular Weight | 370.33 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | [(2R,5S)-2-(5-fluoro-2,4-dioxopyrimidin-1-yl)-5-methyl-2H-furan-5-yl]methyl 2-acetyloxy-2-methylpropanoate |
| SMILES | CC(=O)OC(C)(C)C(=O)OC[C@]1(C)C=C[C@H](n2cc(F)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C16H19FN2O7/c1-9(20)25-15(2,3)13(22)24-8-16(4)6-5-11(26-16)19-7-10(17)12(21)18-14(19)23/h5-7,11H,8H2,1-4H3,(H,18,21,23)/t11-,16+/m1/s1 |
| InChIKey | FXKZPNIOEHBBLT-BZNIZROVSA-N |
| XLogP | 0.40 |
| TPSA | 116.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.33 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|