C12H24IN5O3 — CID 170172763
imidazolidin-1-ylurea;1-iodoprop-1-enyl N-butylcarbamate (PubChem CID 170172763) has the molecular formula C12H24IN5O3 and a molecular weight of 413.26 g/mol. Its IUPAC name is imidazolidin-1-ylurea;1-iodoprop-1-enyl N-butylcarbamate.
| Compound Name | imidazolidin-1-ylurea;1-iodoprop-1-enyl N-butylcarbamate |
|---|---|
| PubChem CID | 170172763 |
| Molecular Formula | C12H24IN5O3 |
| Molecular Weight | 413.26 g/mol |
| Exact Mass | 413.09 |
| IUPAC Name | imidazolidin-1-ylurea;1-iodoprop-1-enyl N-butylcarbamate |
| SMILES | CC=C(I)OC(=O)NCCCC.NC(=O)NN1CCNC1 |
| InChI | InChI=1S/C8H14INO2.C4H10N4O/c1-3-5-6-10-8(11)12-7(9)4-2;5-4(9)7-8-2-1-6-3-8/h4H,3,5-6H2,1-2H3,(H,10,11);6H,1-3H2,(H3,5,7,9) |
| InChIKey | IKVFFIKSTZPQFW-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|