C14H28N4 — CID 170175800
(E,8Z)-1-N-methyl-8-(methylidenehydrazinylidene)-3-propylnon-6-ene-1,6-diamine (PubChem CID 170175800) has the molecular formula C14H28N4 and a molecular weight of 252.41 g/mol. Its IUPAC name is (E,8Z)-1-N-methyl-8-(methylidenehydrazinylidene)-3-propylnon-6-ene-1,6-diamine.
| Compound Name | (E,8Z)-1-N-methyl-8-(methylidenehydrazinylidene)-3-propylnon-6-ene-1,6-diamine |
|---|---|
| PubChem CID | 170175800 |
| Molecular Formula | C14H28N4 |
| Molecular Weight | 252.41 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | (E,8Z)-1-N-methyl-8-(methylidenehydrazinylidene)-3-propylnon-6-ene-1,6-diamine |
| SMILES | C=N/N=C(C)\C=C(\N)CCC(CCC)CCNC |
| InChI | InChI=1S/C14H28N4/c1-5-6-13(9-10-16-3)7-8-14(15)11-12(2)18-17-4/h11,13,16H,4-10,15H2,1-3H3/b14-11+,18-12- |
| InChIKey | MNYLJKOUVKHPJX-UJUKKVGJSA-N |
| XLogP | 2.71 |
| TPSA | 62.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.41 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|