C32H35N5O — CID 170176545
[3-(dimethylamino)azetidin-1-yl]-[4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]methanone (PubChem CID 170176545) has the molecular formula C32H35N5O and a molecular weight of 505.67 g/mol. Its IUPAC name is [3-(dimethylamino)azetidin-1-yl]-[4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]methanone.
| Compound Name | [3-(dimethylamino)azetidin-1-yl]-[4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]methanone |
|---|---|
| PubChem CID | 170176545 |
| Molecular Formula | C32H35N5O |
| Molecular Weight | 505.67 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | [3-(dimethylamino)azetidin-1-yl]-[4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]phenyl]methanone |
| SMILES | CN1Cc2cc(-c3cnc4[nH]cc(-c5ccc(C(=O)N6CC(N(C)C)C6)cc5)c4c3)cc3c2C(CCC3)C1 |
| InChI | InChI=1S/C32H35N5O/c1-35(2)27-18-37(19-27)32(38)21-9-7-20(8-10-21)29-15-34-31-28(29)13-25(14-33-31)24-11-22-5-4-6-23-16-36(3)17-26(12-24)30(22)23/h7-15,23,27H,4-6,16-19H2,1-3H3,(H,33,34) |
| InChIKey | IWOZMDLXKZWDAV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 55.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.67 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |