C31H34N4O2 — CID 170176504
4-[5-[2-(2-methoxyethyl)-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethylbenzamide (PubChem CID 170176504) has the molecular formula C31H34N4O2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 4-[5-[2-(2-methoxyethyl)-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethylbenzamide.
| Compound Name | 4-[5-[2-(2-methoxyethyl)-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 170176504 |
| Molecular Formula | C31H34N4O2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.27 |
| IUPAC Name | 4-[5-[2-(2-methoxyethyl)-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl]-1H-pyrrolo[2,3-b]pyridin-3-yl]-N,N-dimethylbenzamide |
| SMILES | COCCN1Cc2cc(-c3cnc4[nH]cc(-c5ccc(C(=O)N(C)C)cc5)c4c3)cc3c2C(CCC3)C1 |
| InChI | InChI=1S/C31H34N4O2/c1-34(2)31(36)21-9-7-20(8-10-21)28-17-33-30-27(28)15-25(16-32-30)24-13-22-5-4-6-23-18-35(11-12-37-3)19-26(14-24)29(22)23/h7-10,13-17,23H,4-6,11-12,18-19H2,1-3H3,(H,32,33) |
| InChIKey | UURIQYHFOLCXCE-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 61.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |