C32H36N4O2 — CID 170176552
N-(2-hydroxy-2-methylpropyl)-N-methyl-4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzamide (PubChem CID 170176552) has the molecular formula C32H36N4O2 and a molecular weight of 508.67 g/mol. Its IUPAC name is N-(2-hydroxy-2-methylpropyl)-N-methyl-4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzamide.
| Compound Name | N-(2-hydroxy-2-methylpropyl)-N-methyl-4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzamide |
|---|---|
| PubChem CID | 170176552 |
| Molecular Formula | C32H36N4O2 |
| Molecular Weight | 508.67 g/mol |
| Exact Mass | 508.28 |
| IUPAC Name | N-(2-hydroxy-2-methylpropyl)-N-methyl-4-[5-(2-methyl-1,3,7,8,9,9a-hexahydrobenzo[de]isoquinolin-5-yl)-1H-pyrrolo[2,3-b]pyridin-3-yl]benzamide |
| SMILES | CN1Cc2cc(-c3cnc4[nH]cc(-c5ccc(C(=O)N(C)CC(C)(C)O)cc5)c4c3)cc3c2C(CCC3)C1 |
| InChI | InChI=1S/C32H36N4O2/c1-32(2,38)19-36(4)31(37)21-10-8-20(9-11-21)28-16-34-30-27(28)14-25(15-33-30)24-12-22-6-5-7-23-17-35(3)18-26(13-24)29(22)23/h8-16,23,38H,5-7,17-19H2,1-4H3,(H,33,34) |
| InChIKey | QETPBDUYJRAXAF-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 72.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.67 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |