C42H74N2O8 — CID 170181381
[4-[(E)-3-[3-(dimethylamino)propoxy]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] 5-[2-hydroxydecyl(2-methoxydecyl)amino]pentanoate (PubChem CID 170181381) has the molecular formula C42H74N2O8 and a molecular weight of 735.06 g/mol. Its IUPAC name is [4-[(E)-3-[3-(dimethylamino)propoxy]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] 5-[2-hydroxydecyl(2-methoxydecyl)amino]pentanoate.
| Compound Name | [4-[(E)-3-[3-(dimethylamino)propoxy]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] 5-[2-hydroxydecyl(2-methoxydecyl)amino]pentanoate |
|---|---|
| PubChem CID | 170181381 |
| Molecular Formula | C42H74N2O8 |
| Molecular Weight | 735.06 g/mol |
| Exact Mass | 734.54 |
| IUPAC Name | [4-[(E)-3-[3-(dimethylamino)propoxy]-3-oxoprop-1-enyl]-2,6-dimethoxyphenyl] 5-[2-hydroxydecyl(2-methoxydecyl)amino]pentanoate |
| SMILES | CCCCCCCCC(O)CN(CCCCC(=O)Oc1c(OC)cc(/C=C/C(=O)OCCCN(C)C)cc1OC)CC(CCCCCCCC)OC |
| InChI | InChI=1S/C42H74N2O8/c1-8-10-12-14-16-18-23-36(45)33-44(34-37(48-5)24-19-17-15-13-11-9-2)29-21-20-25-41(47)52-42-38(49-6)31-35(32-39(42)50-7)26-27-40(46)51-30-22-28-43(3)4/h26-27,31-32,36-37,45H,8-25,28-30,33-34H2,1-7H3/b27-26+ |
| InChIKey | VZPMMSCKZVMIPL-CYYJNZCTSA-N |
| XLogP | 8.47 |
| TPSA | 107.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 735.06 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|