C27H39NOS — CID 170184062
(3R,5R,8S,9R,10S,13S,14S,17S)-3-hydroxy-3,9,13-trimethyl-N-phenyl-1,2,4,5,6,7,8,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbothioamide (PubChem CID 170184062) has the molecular formula C27H39NOS and a molecular weight of 425.68 g/mol. Its IUPAC name is (3R,5R,8S,9R,10S,13S,14S,17S)-3-hydroxy-3,9,13-trimethyl-N-phenyl-1,2,4,5,6,7,8,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbothioamide.
| Compound Name | (3R,5R,8S,9R,10S,13S,14S,17S)-3-hydroxy-3,9,13-trimethyl-N-phenyl-1,2,4,5,6,7,8,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbothioamide |
|---|---|
| PubChem CID | 170184062 |
| Molecular Formula | C27H39NOS |
| Molecular Weight | 425.68 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | (3R,5R,8S,9R,10S,13S,14S,17S)-3-hydroxy-3,9,13-trimethyl-N-phenyl-1,2,4,5,6,7,8,10,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-17-carbothioamide |
| SMILES | C[C@@]1(O)CC[C@H]2[C@H](CC[C@H]3[C@@H]4CC[C@H](C(=S)Nc5ccccc5)[C@@]4(C)CC[C@]23C)C1 |
| InChI | InChI=1S/C27H39NOS/c1-25(29)14-13-20-18(17-25)9-10-21-22-11-12-23(27(22,3)16-15-26(20,21)2)24(30)28-19-7-5-4-6-8-19/h4-8,18,20-23,29H,9-17H2,1-3H3,(H,28,30)/t18-,20+,21+,22+,23-,25-,26-,27+/m1/s1 |
| InChIKey | RRZMUWBMDDEUAM-OAQXRMBBSA-N |
| XLogP | 6.84 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.68 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|