C26H28FNO6 — CID 170189303
2-[[4-fluoro-3-[2-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enoxy]phenyl]phenyl]methyl]-3-oxopiperidine-1-carboxylic acid (PubChem CID 170189303) has the molecular formula C26H28FNO6 and a molecular weight of 469.51 g/mol. Its IUPAC name is 2-[[4-fluoro-3-[2-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enoxy]phenyl]phenyl]methyl]-3-oxopiperidine-1-carboxylic acid.
| Compound Name | 2-[[4-fluoro-3-[2-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enoxy]phenyl]phenyl]methyl]-3-oxopiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 170189303 |
| Molecular Formula | C26H28FNO6 |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 2-[[4-fluoro-3-[2-[(E)-3-[(2-methylpropan-2-yl)oxy]-3-oxoprop-1-enoxy]phenyl]phenyl]methyl]-3-oxopiperidine-1-carboxylic acid |
| SMILES | CC(C)(C)OC(=O)/C=C/Oc1ccccc1-c1cc(CC2C(=O)CCCN2C(=O)O)ccc1F |
| InChI | InChI=1S/C26H28FNO6/c1-26(2,3)34-24(30)12-14-33-23-9-5-4-7-18(23)19-15-17(10-11-20(19)27)16-21-22(29)8-6-13-28(21)25(31)32/h4-5,7,9-12,14-15,21H,6,8,13,16H2,1-3H3,(H,31,32)/b14-12+ |
| InChIKey | XDTVAOLTDYWDEF-WYMLVPIESA-N |
| XLogP | 4.98 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|