C20H30N3O4PS2 — CID 170190651
1-[(2R,4S,5R)-4-[[(2R,3aS,6R,7aS)-3a-methyl-6-prop-1-en-2-yl-2-sulfanylidene-5,6,7,7a-tetrahydro-4H-benzo[d][1,3,2]oxathiaphosphol-2-yl]oxy]-5-ethyloxolan-2-yl]-4-aminopyrimidin-2-one (PubChem CID 170190651) has the molecular formula C20H30N3O4PS2 and a molecular weight of 471.59 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[[(2R,3aS,6R,7aS)-3a-methyl-6-prop-1-en-2-yl-2-sulfanylidene-5,6,7,7a-tetrahydro-4H-benzo[d][1,3,2]oxathiaphosphol-2-yl]oxy]-5-ethyloxolan-2-yl]-4-aminopyrimidin-2-one.
| Compound Name | 1-[(2R,4S,5R)-4-[[(2R,3aS,6R,7aS)-3a-methyl-6-prop-1-en-2-yl-2-sulfanylidene-5,6,7,7a-tetrahydro-4H-benzo[d][1,3,2]oxathiaphosphol-2-yl]oxy]-5-ethyloxolan-2-yl]-4-aminopyrimidin-2-one |
|---|---|
| PubChem CID | 170190651 |
| Molecular Formula | C20H30N3O4PS2 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.14 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[[(2R,3aS,6R,7aS)-3a-methyl-6-prop-1-en-2-yl-2-sulfanylidene-5,6,7,7a-tetrahydro-4H-benzo[d][1,3,2]oxathiaphosphol-2-yl]oxy]-5-ethyloxolan-2-yl]-4-aminopyrimidin-2-one |
| SMILES | C=C(C)[C@@H]1CC[C@]2(C)S[P@](=S)(O[C@H]3C[C@H](n4ccc(N)nc4=O)O[C@@H]3CC)O[C@H]2C1 |
| InChI | InChI=1S/C20H30N3O4PS2/c1-5-14-15(11-18(25-14)23-9-7-17(21)22-19(23)24)26-28(29)27-16-10-13(12(2)3)6-8-20(16,4)30-28/h7,9,13-16,18H,2,5-6,8,10-11H2,1,3-4H3,(H2,21,22,24)/t13-,14-,15+,16+,18-,20+,28-/m1/s1 |
| InChIKey | ZLOPDNJDXPZXGI-ICYXVNFVSA-N |
| XLogP | 4.40 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|