C20H29N2O5PS2 — CID 170190578
1-[(2R,4S,5R)-4-[[(2S,3aR,5S,7aR)-7a-methyl-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphol-2-yl]oxy]-5-ethyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 170190578) has the molecular formula C20H29N2O5PS2 and a molecular weight of 472.57 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-[[(2S,3aR,5S,7aR)-7a-methyl-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphol-2-yl]oxy]-5-ethyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5R)-4-[[(2S,3aR,5S,7aR)-7a-methyl-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphol-2-yl]oxy]-5-ethyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 170190578 |
| Molecular Formula | C20H29N2O5PS2 |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.13 |
| IUPAC Name | 1-[(2R,4S,5R)-4-[[(2S,3aR,5S,7aR)-7a-methyl-5-prop-1-en-2-yl-2-sulfanylidene-4,5,6,7-tetrahydro-3aH-benzo[d][1,3,2]oxathiaphosphol-2-yl]oxy]-5-ethyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C=C(C)[C@H]1CC[C@@]2(C)O[P@](=S)(O[C@H]3C[C@H](n4ccc(=O)[nH]c4=O)O[C@@H]3CC)S[C@@H]2C1 |
| InChI | InChI=1S/C20H29N2O5PS2/c1-5-14-15(11-18(25-14)22-9-7-17(23)21-19(22)24)26-28(29)27-20(4)8-6-13(12(2)3)10-16(20)30-28/h7,9,13-16,18H,2,5-6,8,10-11H2,1,3-4H3,(H,21,23,24)/t13-,14+,15-,16+,18+,20+,28-/m0/s1 |
| InChIKey | VQOIHEGWAXSWEX-VHKIENHXSA-N |
| XLogP | 4.11 |
| TPSA | 82.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|