C37H46N4O9 — CID 170195157
2-[[(1S)-5-[[(2S)-3-anthracen-9-yl-2-(cyclohexanecarbonylamino)propanoyl]amino]-1-carboxypentyl]carbamoylamino]hexanedioic acid (PubChem CID 170195157) has the molecular formula C37H46N4O9 and a molecular weight of 690.79 g/mol. Its IUPAC name is 2-[[(1S)-5-[[(2S)-3-anthracen-9-yl-2-(cyclohexanecarbonylamino)propanoyl]amino]-1-carboxypentyl]carbamoylamino]hexanedioic acid.
| Compound Name | 2-[[(1S)-5-[[(2S)-3-anthracen-9-yl-2-(cyclohexanecarbonylamino)propanoyl]amino]-1-carboxypentyl]carbamoylamino]hexanedioic acid |
|---|---|
| PubChem CID | 170195157 |
| Molecular Formula | C37H46N4O9 |
| Molecular Weight | 690.79 g/mol |
| Exact Mass | 690.33 |
| IUPAC Name | 2-[[(1S)-5-[[(2S)-3-anthracen-9-yl-2-(cyclohexanecarbonylamino)propanoyl]amino]-1-carboxypentyl]carbamoylamino]hexanedioic acid |
| SMILES | O=C(O)CCCC(NC(=O)N[C@@H](CCCCNC(=O)[C@H](Cc1c2ccccc2cc2ccccc12)NC(=O)C1CCCCC1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C37H46N4O9/c42-32(43)19-10-18-30(36(48)49)41-37(50)40-29(35(46)47)17-8-9-20-38-34(45)31(39-33(44)23-11-2-1-3-12-23)22-28-26-15-6-4-13-24(26)21-25-14-5-7-16-27(25)28/h4-7,13-16,21,23,29-31H,1-3,8-12,17-20,22H2,(H,38,45)(H,39,44)(H,42,43)(H,46,47)(H,48,49)(H2,40,41,50)/t29-,30?,31-/m0/s1 |
| InChIKey | CTAMSKOSVXXQTH-GAVYTZHXSA-N |
| XLogP | 4.35 |
| TPSA | 211.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.79 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|