C36H46N4O9 — CID 170732911
(2S)-2-[[(1S)-1-carboxy-5-[[2-(cyclohexanecarbonylamino)acetyl]amino]pentyl]carbamoylamino]pentanedioic acid;9-methylanthracene (PubChem CID 170732911) has the molecular formula C36H46N4O9 and a molecular weight of 678.78 g/mol. Its IUPAC name is (2S)-2-[[(1S)-1-carboxy-5-[[2-(cyclohexanecarbonylamino)acetyl]amino]pentyl]carbamoylamino]pentanedioic acid;9-methylanthracene.
| Compound Name | (2S)-2-[[(1S)-1-carboxy-5-[[2-(cyclohexanecarbonylamino)acetyl]amino]pentyl]carbamoylamino]pentanedioic acid;9-methylanthracene |
|---|---|
| PubChem CID | 170732911 |
| Molecular Formula | C36H46N4O9 |
| Molecular Weight | 678.78 g/mol |
| Exact Mass | 678.33 |
| IUPAC Name | (2S)-2-[[(1S)-1-carboxy-5-[[2-(cyclohexanecarbonylamino)acetyl]amino]pentyl]carbamoylamino]pentanedioic acid;9-methylanthracene |
| SMILES | Cc1c2ccccc2cc2ccccc12.O=C(O)CC[C@H](NC(=O)N[C@@H](CCCCNC(=O)CNC(=O)C1CCCCC1)C(=O)O)C(=O)O |
| InChI | InChI=1S/C21H34N4O9.C15H12/c26-16(12-23-18(29)13-6-2-1-3-7-13)22-11-5-4-8-14(19(30)31)24-21(34)25-15(20(32)33)9-10-17(27)28;1-11-14-8-4-2-6-12(14)10-13-7-3-5-9-15(11)13/h13-15H,1-12H2,(H,22,26)(H,23,29)(H,27,28)(H,30,31)(H,32,33)(H2,24,25,34);2-10H,1H3/t14-,15-;/m0./s1 |
| InChIKey | LIMJQGPXJOGUCR-YYLIZZNMSA-N |
| XLogP | 4.34 |
| TPSA | 211.23 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.78 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|